Salts and Inorganics
A variety of inorganic salts and elemental metals that can be used for large-scale, industrial purposes and everyday laboratory applications. Products are available in a range of chemical compositions, quantities, purities, and reagent grades.
Inorganics are elements and compounds, including carbon monoxide, carbon dioxide, carbonates, cyanides, cyanates, and carbides, that do not contain a carbon-hydrogen bond. This group also includes carbon allotropes such as graphite and graphene.
Because organic chemicals include only those that contain carbon atoms bonded to hydrogen atoms, the majority of elements in the periodic table and most substances in the material world are considered to be inorganic chemicals.
Filtered Search Results
Tin(IV) chloride, 99.99% (metals basis)
CAS: 7646-78-8 Molecular Formula: Cl4Sn Molecular Weight (g/mol): 260.51 MDL Number: MFCD00011242 InChI Key: HPGGPRDJHPYFRM-UHFFFAOYSA-J Synonym: tin tetrachloride,tin iv chloride,stannane, tetrachloro,tin chloride,stannic chloride,tetrachlorotin,tin perchloride,tintetrachloride,tin iv tetrachloride,sncl4 PubChem CID: 24287 IUPAC Name: tetrachlorostannane SMILES: Cl[Sn](Cl)(Cl)Cl
| PubChem CID | 24287 |
|---|---|
| CAS | 7646-78-8 |
| Molecular Weight (g/mol) | 260.51 |
| MDL Number | MFCD00011242 |
| SMILES | Cl[Sn](Cl)(Cl)Cl |
| Synonym | tin tetrachloride,tin iv chloride,stannane, tetrachloro,tin chloride,stannic chloride,tetrachlorotin,tin perchloride,tintetrachloride,tin iv tetrachloride,sncl4 |
| IUPAC Name | tetrachlorostannane |
| InChI Key | HPGGPRDJHPYFRM-UHFFFAOYSA-J |
| Molecular Formula | Cl4Sn |
Manganese powder, APS <10 micron, 99.6% (metals basis)
CAS: 7439-96-5 Molecular Formula: Mn Molecular Weight (g/mol): 54.94 MDL Number: MFCD00011111 InChI Key: PWHULOQIROXLJO-UHFFFAOYSA-N Synonym: colloidal,mangan,manganese, elemental,cutaval,magnacat,metal alloy,tronamang,fume,mangan polish,compounds PubChem CID: 23930 ChEBI: CHEBI:35154 IUPAC Name: manganese SMILES: [Mn]
| PubChem CID | 23930 |
|---|---|
| CAS | 7439-96-5 |
| Molecular Weight (g/mol) | 54.94 |
| ChEBI | CHEBI:35154 |
| MDL Number | MFCD00011111 |
| SMILES | [Mn] |
| Synonym | colloidal,mangan,manganese, elemental,cutaval,magnacat,metal alloy,tronamang,fume,mangan polish,compounds |
| IUPAC Name | manganese |
| InChI Key | PWHULOQIROXLJO-UHFFFAOYSA-N |
| Molecular Formula | Mn |
Aluminum wire, 0.152mm (0.006in) dia, hard, Puratronic™, 99.999% (metals basis)
CAS: 7429-90-5 Molecular Formula: Al Molecular Weight (g/mol): 26.98 MDL Number: MFCD00134029 InChI Key: XAGFODPZIPBFFR-UHFFFAOYSA-N Synonym: aluminum,metal,powder,aluminio,metana,adom,alumina fibre,aluminum flake,dust,noral aluminum PubChem CID: 5359268 ChEBI: CHEBI:33629 IUPAC Name: aluminum SMILES: [Al]
| PubChem CID | 5359268 |
|---|---|
| CAS | 7429-90-5 |
| Molecular Weight (g/mol) | 26.98 |
| ChEBI | CHEBI:33629 |
| MDL Number | MFCD00134029 |
| SMILES | [Al] |
| Synonym | aluminum,metal,powder,aluminio,metana,adom,alumina fibre,aluminum flake,dust,noral aluminum |
| IUPAC Name | aluminum |
| InChI Key | XAGFODPZIPBFFR-UHFFFAOYSA-N |
| Molecular Formula | Al |
| Name Note | 0.81mm (0.032 in.) thick |
|---|---|
| Form | Foil |
| MDL Number | MFCD00171255 |
| Chemical Name or Material | Brass foil, Alloy 260 |
| TSCA | Yes |
| Recommended Storage | Ambient temperatures |
| Odor | Odorless |
Silicon powder, -325 mesh, 99.999% (metals basis)
CAS: 7440-21-3 Molecular Formula: Si Molecular Weight (g/mol): 28.09 MDL Number: MFCD00085311 InChI Key: XUIMIQQOPSSXEZ-UHFFFAOYSA-N Synonym: metal,silicone,defoamer s-10,flots 100sco,powder,dust,unii-z4152n8iui,polyeristalline powder,ccris 6599,ccris 6831 PubChem CID: 5461123 ChEBI: CHEBI:27573 IUPAC Name: silicon SMILES: [Si]
| PubChem CID | 5461123 |
|---|---|
| CAS | 7440-21-3 |
| Molecular Weight (g/mol) | 28.09 |
| ChEBI | CHEBI:27573 |
| MDL Number | MFCD00085311 |
| SMILES | [Si] |
| Synonym | metal,silicone,defoamer s-10,flots 100sco,powder,dust,unii-z4152n8iui,polyeristalline powder,ccris 6599,ccris 6831 |
| IUPAC Name | silicon |
| InChI Key | XUIMIQQOPSSXEZ-UHFFFAOYSA-N |
| Molecular Formula | Si |
Gadolinium(III) acetate hydrate, 99.9% (REO)
CAS: 100587-93-7 Molecular Formula: C6H9GdO6 Molecular Weight (g/mol): 334.38 MDL Number: MFCD00150116 InChI Key: LYQGMALGKYWNIU-UHFFFAOYSA-K IUPAC Name: gadolinium(3+) triacetate SMILES: [Gd+3].CC([O-])=O.CC([O-])=O.CC([O-])=O
| CAS | 100587-93-7 |
|---|---|
| Molecular Weight (g/mol) | 334.38 |
| MDL Number | MFCD00150116 |
| SMILES | [Gd+3].CC([O-])=O.CC([O-])=O.CC([O-])=O |
| IUPAC Name | gadolinium(3+) triacetate |
| InChI Key | LYQGMALGKYWNIU-UHFFFAOYSA-K |
| Molecular Formula | C6H9GdO6 |
Aluminum potassium sulfate dodecahydrate, 98+%
CAS: 7784-24-9 Molecular Formula: AlH24KO20S2 Molecular Weight (g/mol): 474.372 MDL Number: MFCD00149143 InChI Key: GNHOJBNSNUXZQA-UHFFFAOYSA-J Synonym: kalinite,aluminum potassium sulfate dodecahydrate,potassium alum dodecahydrate,potash alum dodecahydrate,aluminum potassium disulfate dodecahydrate,unii-1l24v9r23s,alum, potassium, dodecahydrate,potassium aluminum sulfate dodecahydrate,aluminum potassium sulfate dodecahydrate,potassium aluminum disulfate dodecahydrate PubChem CID: 62667 ChEBI: CHEBI:86465 IUPAC Name: aluminum;potassium;disulfate;dodecahydrate SMILES: O.O.O.O.O.O.O.O.O.O.O.O.[O-]S(=O)(=O)[O-].[O-]S(=O)(=O)[O-].[Al+3].[K+]
| PubChem CID | 62667 |
|---|---|
| CAS | 7784-24-9 |
| Molecular Weight (g/mol) | 474.372 |
| ChEBI | CHEBI:86465 |
| MDL Number | MFCD00149143 |
| SMILES | O.O.O.O.O.O.O.O.O.O.O.O.[O-]S(=O)(=O)[O-].[O-]S(=O)(=O)[O-].[Al+3].[K+] |
| Synonym | kalinite,aluminum potassium sulfate dodecahydrate,potassium alum dodecahydrate,potash alum dodecahydrate,aluminum potassium disulfate dodecahydrate,unii-1l24v9r23s,alum, potassium, dodecahydrate,potassium aluminum sulfate dodecahydrate,aluminum potassium sulfate dodecahydrate,potassium aluminum disulfate dodecahydrate |
| IUPAC Name | aluminum;potassium;disulfate;dodecahydrate |
| InChI Key | GNHOJBNSNUXZQA-UHFFFAOYSA-J |
| Molecular Formula | AlH24KO20S2 |
Phosphorus(V) oxide, 99.99%
CAS: 1314-56-3 Molecular Formula: O5P2 Molecular Weight (g/mol): 141.94 MDL Number: MFCD00011440 InChI Key: DLYUQMMRRRQYAE-UHFFFAOYSA-N IUPAC Name: tricyclo[3.3.1.1³,⁷]tetraphosphoxane-1,3,5,7-tetrone SMILES: O=P12OP3(=O)OP(=O)(O1)OP(=O)(O2)O3
| CAS | 1314-56-3 |
|---|---|
| Molecular Weight (g/mol) | 141.94 |
| MDL Number | MFCD00011440 |
| SMILES | O=P12OP3(=O)OP(=O)(O1)OP(=O)(O2)O3 |
| IUPAC Name | tricyclo[3.3.1.1³,⁷]tetraphosphoxane-1,3,5,7-tetrone |
| InChI Key | DLYUQMMRRRQYAE-UHFFFAOYSA-N |
| Molecular Formula | O5P2 |
| Name Note | 200 mesh woven from 0.053mm (0.0021 in.) dia. wire |
|---|---|
| MDL Number | MFCD00198187 |
| Chemical Name or Material | Bronze gauze, Alloy 220 |
| TSCA | Yes |
| Recommended Storage | Ambient temperatures |
| Odor | Odorless |
| Mesh Size | 200 Mesh |
Gadolinium ingot/button, =50.8mm (2.0in) dia, 99% (REO)
CAS: 7440-54-2 Molecular Formula: Gd Molecular Weight (g/mol): 157.25 MDL Number: MFCD00011022 InChI Key: UIWYJDYFSGRHKR-UHFFFAOYSA-N Synonym: atom,gadolinio,unii-au0v1lm3jt,trihydride,au0v1lm3jt,foil, 3n,gadolinium, elemental,ingot,gadolinium, chips,compounds PubChem CID: 23982 ChEBI: CHEBI:33375 IUPAC Name: gadolinium SMILES: [Gd]
| PubChem CID | 23982 |
|---|---|
| CAS | 7440-54-2 |
| Molecular Weight (g/mol) | 157.25 |
| ChEBI | CHEBI:33375 |
| MDL Number | MFCD00011022 |
| SMILES | [Gd] |
| Synonym | atom,gadolinio,unii-au0v1lm3jt,trihydride,au0v1lm3jt,foil, 3n,gadolinium, elemental,ingot,gadolinium, chips,compounds |
| IUPAC Name | gadolinium |
| InChI Key | UIWYJDYFSGRHKR-UHFFFAOYSA-N |
| Molecular Formula | Gd |
Boron Nitride Rod;Diameter (mm), 6.4;Length (mm), 300
CAS: 10043-11-5 Molecular Formula: BN Molecular Weight (g/mol): 24.82 MDL Number: MFCD00011317 InChI Key: LNLSXDSWJBUPHM-UHFFFAOYSA-N Synonym: boron nitride,elbor,borazon,elboron,kubonit,wurzin,denka boron nitride gp,geksanit r,hexanite r PubChem CID: 66227 ChEBI: CHEBI:50883 IUPAC Name: boranimine SMILES: B=N
| PubChem CID | 66227 |
|---|---|
| CAS | 10043-11-5 |
| Molecular Weight (g/mol) | 24.82 |
| ChEBI | CHEBI:50883 |
| MDL Number | MFCD00011317 |
| SMILES | B=N |
| Synonym | boron nitride,elbor,borazon,elboron,kubonit,wurzin,denka boron nitride gp,geksanit r,hexanite r |
| IUPAC Name | boranimine |
| InChI Key | LNLSXDSWJBUPHM-UHFFFAOYSA-N |
| Molecular Formula | BN |
Titanium foil, 1.6mm (0.063in) thick, annealed, 99.2% (metals basis)
CAS: 7440-32-6 Molecular Formula: Ti Molecular Weight (g/mol): 47.87 MDL Number: MFCD00011264,MFCD00151301 InChI Key: RTAQQCXQSZGOHL-UHFFFAOYSA-N Synonym: oremet,alloy,cp,vt1,c.p.,contimet 30,jistp28,titanium-125,ii hydride,titan vt 1-1 PubChem CID: 23963 ChEBI: CHEBI:33341 IUPAC Name: titanium SMILES: [Ti]
| PubChem CID | 23963 |
|---|---|
| CAS | 7440-32-6 |
| Molecular Weight (g/mol) | 47.87 |
| ChEBI | CHEBI:33341 |
| MDL Number | MFCD00011264,MFCD00151301 |
| SMILES | [Ti] |
| Synonym | oremet,alloy,cp,vt1,c.p.,contimet 30,jistp28,titanium-125,ii hydride,titan vt 1-1 |
| IUPAC Name | titanium |
| InChI Key | RTAQQCXQSZGOHL-UHFFFAOYSA-N |
| Molecular Formula | Ti |
Silver chloride, 4.9% in H{2}O, nanoparticle dispersion, <200nm APS Number Weighted
CAS: 7783-90-6 Molecular Formula: AgCl Molecular Weight (g/mol): 143.32 MDL Number: MFCD00003399 InChI Key: HKZLPVFGJNLROG-UHFFFAOYSA-M Synonym: Silver chloride dispersion in water IUPAC Name: silver(1+) chloride SMILES: [Cl-].[Ag+]
| CAS | 7783-90-6 |
|---|---|
| Molecular Weight (g/mol) | 143.32 |
| MDL Number | MFCD00003399 |
| SMILES | [Cl-].[Ag+] |
| Synonym | Silver chloride dispersion in water |
| IUPAC Name | silver(1+) chloride |
| InChI Key | HKZLPVFGJNLROG-UHFFFAOYSA-M |
| Molecular Formula | AgCl |
Thermo Scientific™ Lithium, Ion chromatography standard solution, Specpure™, Li++ 1000μg/ml
Molecular Formula: LiNO{3} in H{2}O MDL Number: MFCD00064606
| MDL Number | MFCD00064606 |
|---|---|
| Molecular Formula | LiNO{3} in H{2}O |
Titanium(IV) isobutoxide
CAS: 7425-80-1 MDL Number: MFCD00015045 Synonym: tetrakis 2-methylpropyl orthosilicate,titanium iv isobutoxide,tetrakis 2-methylpropyl silicate,tetraisobutyl orthosilicate,silane, tetraisobutoxy,silicic acid tetraisobutyl ester,orthosilicic acid tetrakis 2-methylpropyl ester,silicic acid h4sio4 ,tetrakis 2-methylpropyl ester PubChem CID: 69626 IUPAC Name: tetrakis(2-methylpropyl) silicate
| PubChem CID | 69626 |
|---|---|
| CAS | 7425-80-1 |
| MDL Number | MFCD00015045 |
| Synonym | tetrakis 2-methylpropyl orthosilicate,titanium iv isobutoxide,tetrakis 2-methylpropyl silicate,tetraisobutyl orthosilicate,silane, tetraisobutoxy,silicic acid tetraisobutyl ester,orthosilicic acid tetrakis 2-methylpropyl ester,silicic acid h4sio4 ,tetrakis 2-methylpropyl ester |
| IUPAC Name | tetrakis(2-methylpropyl) silicate |